C11H21NO2 — CID 114623874
1-(2,2,5,5-tetramethyloxolan-3-yl)azetidin-3-ol (PubChem CID 114623874) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 1-(2,2,5,5-tetramethyloxolan-3-yl)azetidin-3-ol.
| Compound Name | 1-(2,2,5,5-tetramethyloxolan-3-yl)azetidin-3-ol |
|---|---|
| PubChem CID | 114623874 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 1-(2,2,5,5-tetramethyloxolan-3-yl)azetidin-3-ol |
| SMILES | CC1(C)CC(N2CC(O)C2)C(C)(C)O1 |
| InChI | InChI=1S/C11H21NO2/c1-10(2)5-9(11(3,4)14-10)12-6-8(13)7-12/h8-9,13H,5-7H2,1-4H3 |
| InChIKey | UEGLXIWFKWTHBE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |