C14H26N2OS — CID 114621322
1-(2,2,5,5-tetramethyloxolan-3-yl)piperidine-3-carbothioamide (PubChem CID 114621322) has the molecular formula C14H26N2OS and a molecular weight of 270.44 g/mol. Its IUPAC name is 1-(2,2,5,5-tetramethyloxolan-3-yl)piperidine-3-carbothioamide.
| Compound Name | 1-(2,2,5,5-tetramethyloxolan-3-yl)piperidine-3-carbothioamide |
|---|---|
| PubChem CID | 114621322 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1-(2,2,5,5-tetramethyloxolan-3-yl)piperidine-3-carbothioamide |
| SMILES | CC1(C)CC(N2CCCC(C(N)=S)C2)C(C)(C)O1 |
| InChI | InChI=1S/C14H26N2OS/c1-13(2)8-11(14(3,4)17-13)16-7-5-6-10(9-16)12(15)18/h10-11H,5-9H2,1-4H3,(H2,15,18) |
| InChIKey | WCWCGIHPLPTOTH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|