C13H21BrN2O2S — CID 114625158
5-amino-4-bromo-N,2-dimethyl-N-pentan-3-ylbenzenesulfonamide (PubChem CID 114625158) has the molecular formula C13H21BrN2O2S and a molecular weight of 349.29 g/mol. Its IUPAC name is 5-amino-4-bromo-N,2-dimethyl-N-pentan-3-ylbenzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N,2-dimethyl-N-pentan-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 114625158 |
| Molecular Formula | C13H21BrN2O2S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 5-amino-4-bromo-N,2-dimethyl-N-pentan-3-ylbenzenesulfonamide |
| SMILES | CCC(CC)N(C)S(=O)(=O)c1cc(N)c(Br)cc1C |
| InChI | InChI=1S/C13H21BrN2O2S/c1-5-10(6-2)16(4)19(17,18)13-8-12(15)11(14)7-9(13)3/h7-8,10H,5-6,15H2,1-4H3 |
| InChIKey | KLQWHMDZJHWBHI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|