C13H20BrN3O3S — CID 114625351
2-[(5-amino-4-bromo-2-methylphenyl)sulfonyl-methylamino]-N-propan-2-ylacetamide (PubChem CID 114625351) has the molecular formula C13H20BrN3O3S and a molecular weight of 378.29 g/mol. Its IUPAC name is 2-[(5-amino-4-bromo-2-methylphenyl)sulfonyl-methylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[(5-amino-4-bromo-2-methylphenyl)sulfonyl-methylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 114625351 |
| Molecular Formula | C13H20BrN3O3S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 2-[(5-amino-4-bromo-2-methylphenyl)sulfonyl-methylamino]-N-propan-2-ylacetamide |
| SMILES | Cc1cc(Br)c(N)cc1S(=O)(=O)N(C)CC(=O)NC(C)C |
| InChI | InChI=1S/C13H20BrN3O3S/c1-8(2)16-13(18)7-17(4)21(19,20)12-6-11(15)10(14)5-9(12)3/h5-6,8H,7,15H2,1-4H3,(H,16,18) |
| InChIKey | AYINXPKVTMODLH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|