C17H26N2OS — CID 114626837
N-[1-(2,5-dimethylphenyl)ethyl]-2-piperidin-4-ylsulfanylacetamide (PubChem CID 114626837) has the molecular formula C17H26N2OS and a molecular weight of 306.48 g/mol. Its IUPAC name is N-[1-(2,5-dimethylphenyl)ethyl]-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-[1-(2,5-dimethylphenyl)ethyl]-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 114626837 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-[1-(2,5-dimethylphenyl)ethyl]-2-piperidin-4-ylsulfanylacetamide |
| SMILES | Cc1ccc(C)c(C(C)NC(=O)CSC2CCNCC2)c1 |
| InChI | InChI=1S/C17H26N2OS/c1-12-4-5-13(2)16(10-12)14(3)19-17(20)11-21-15-6-8-18-9-7-15/h4-5,10,14-15,18H,6-9,11H2,1-3H3,(H,19,20) |
| InChIKey | UXNIBXMPKKIABU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |