C15H20F2N2OS — CID 114626722
N-[1-(3,4-difluorophenyl)ethyl]-2-piperidin-4-ylsulfanylacetamide (PubChem CID 114626722) has the molecular formula C15H20F2N2OS and a molecular weight of 314.40 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 114626722 |
| Molecular Formula | C15H20F2N2OS |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-2-piperidin-4-ylsulfanylacetamide |
| SMILES | CC(NC(=O)CSC1CCNCC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H20F2N2OS/c1-10(11-2-3-13(16)14(17)8-11)19-15(20)9-21-12-4-6-18-7-5-12/h2-3,8,10,12,18H,4-7,9H2,1H3,(H,19,20) |
| InChIKey | WOCNDCWJFOBLDA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |