C15H24N2O3S — CID 114627631
3-[(2-piperidin-4-ylsulfanylacetyl)amino]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 114627631) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 3-[(2-piperidin-4-ylsulfanylacetyl)amino]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 3-[(2-piperidin-4-ylsulfanylacetyl)amino]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 114627631 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-[(2-piperidin-4-ylsulfanylacetyl)amino]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(CSC1CCNCC1)NC1C2CCC(C2)C1C(=O)O |
| InChI | InChI=1S/C15H24N2O3S/c18-12(8-21-11-3-5-16-6-4-11)17-14-10-2-1-9(7-10)13(14)15(19)20/h9-11,13-14,16H,1-8H2,(H,17,18)(H,19,20) |
| InChIKey | BONJFSQWGIWIFE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |