C13H23N3O2S — CID 114628005
N-[1-(2-piperidin-4-ylsulfanylacetyl)pyrrolidin-3-yl]acetamide (PubChem CID 114628005) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is N-[1-(2-piperidin-4-ylsulfanylacetyl)pyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-(2-piperidin-4-ylsulfanylacetyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 114628005 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[1-(2-piperidin-4-ylsulfanylacetyl)pyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCN(C(=O)CSC2CCNCC2)C1 |
| InChI | InChI=1S/C13H23N3O2S/c1-10(17)15-11-4-7-16(8-11)13(18)9-19-12-2-5-14-6-3-12/h11-12,14H,2-9H2,1H3,(H,15,17) |
| InChIKey | PAFOYBUMTJOLBX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |