C13H25N3O3S2 — CID 114626952
N-[1-(2-piperidin-4-ylsulfanylacetyl)piperidin-4-yl]methanesulfonamide (PubChem CID 114626952) has the molecular formula C13H25N3O3S2 and a molecular weight of 335.50 g/mol. Its IUPAC name is N-[1-(2-piperidin-4-ylsulfanylacetyl)piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-(2-piperidin-4-ylsulfanylacetyl)piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 114626952 |
| Molecular Formula | C13H25N3O3S2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[1-(2-piperidin-4-ylsulfanylacetyl)piperidin-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN(C(=O)CSC2CCNCC2)CC1 |
| InChI | InChI=1S/C13H25N3O3S2/c1-21(18,19)15-11-4-8-16(9-5-11)13(17)10-20-12-2-6-14-7-3-12/h11-12,14-15H,2-10H2,1H3 |
| InChIKey | NJCATNQBJABPQW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |