C16H34N2S — CID 114628792
2,2-dimethyl-N-(2-piperidin-4-ylsulfanylethyl)heptan-1-amine (PubChem CID 114628792) has the molecular formula C16H34N2S and a molecular weight of 286.53 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-piperidin-4-ylsulfanylethyl)heptan-1-amine.
| Compound Name | 2,2-dimethyl-N-(2-piperidin-4-ylsulfanylethyl)heptan-1-amine |
|---|---|
| PubChem CID | 114628792 |
| Molecular Formula | C16H34N2S |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 2,2-dimethyl-N-(2-piperidin-4-ylsulfanylethyl)heptan-1-amine |
| SMILES | CCCCCC(C)(C)CNCCSC1CCNCC1 |
| InChI | InChI=1S/C16H34N2S/c1-4-5-6-9-16(2,3)14-18-12-13-19-15-7-10-17-11-8-15/h15,17-18H,4-14H2,1-3H3 |
| InChIKey | PELHFTMAZKEJAI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|