C15H32N2S — CID 114628486
2,4,4-trimethyl-N-(2-piperidin-4-ylsulfanylethyl)pentan-2-amine (PubChem CID 114628486) has the molecular formula C15H32N2S and a molecular weight of 272.50 g/mol. Its IUPAC name is 2,4,4-trimethyl-N-(2-piperidin-4-ylsulfanylethyl)pentan-2-amine.
| Compound Name | 2,4,4-trimethyl-N-(2-piperidin-4-ylsulfanylethyl)pentan-2-amine |
|---|---|
| PubChem CID | 114628486 |
| Molecular Formula | C15H32N2S |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 2,4,4-trimethyl-N-(2-piperidin-4-ylsulfanylethyl)pentan-2-amine |
| SMILES | CC(C)(C)CC(C)(C)NCCSC1CCNCC1 |
| InChI | InChI=1S/C15H32N2S/c1-14(2,3)12-15(4,5)17-10-11-18-13-6-8-16-9-7-13/h13,16-17H,6-12H2,1-5H3 |
| InChIKey | QECWCUDVJOCIBO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|