C14H28N2S — CID 114628750
2,2,3,3-tetramethyl-N-(2-piperidin-4-ylsulfanylethyl)cyclopropan-1-amine (PubChem CID 114628750) has the molecular formula C14H28N2S and a molecular weight of 256.46 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-N-(2-piperidin-4-ylsulfanylethyl)cyclopropan-1-amine.
| Compound Name | 2,2,3,3-tetramethyl-N-(2-piperidin-4-ylsulfanylethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 114628750 |
| Molecular Formula | C14H28N2S |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2,2,3,3-tetramethyl-N-(2-piperidin-4-ylsulfanylethyl)cyclopropan-1-amine |
| SMILES | CC1(C)C(NCCSC2CCNCC2)C1(C)C |
| InChI | InChI=1S/C14H28N2S/c1-13(2)12(14(13,3)4)16-9-10-17-11-5-7-15-8-6-11/h11-12,15-16H,5-10H2,1-4H3 |
| InChIKey | ZNHUSEDJAMBUCM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|