C22H18N2O2S — CID 11462972
14-[2-(dimethylamino)ethyl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione (PubChem CID 11462972) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 14-[2-(dimethylamino)ethyl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione.
| Compound Name | 14-[2-(dimethylamino)ethyl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione |
|---|---|
| PubChem CID | 11462972 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 14-[2-(dimethylamino)ethyl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione |
| SMILES | CN(C)CCn1c(=O)c2ccc3sc4ccccc4c4ccc(c1=O)c2c34 |
| InChI | InChI=1S/C22H18N2O2S/c1-23(2)11-12-24-21(25)15-8-7-14-13-5-3-4-6-17(13)27-18-10-9-16(22(24)26)19(15)20(14)18/h3-10H,11-12H2,1-2H3 |
| InChIKey | BGKVLOZDBCATTP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|