C13H19N3O4 — CID 114630719
1-ethyl-N-(3-hydroxy-2,2-dimethylcyclobutyl)-4-nitropyrrole-2-carboxamide (PubChem CID 114630719) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-ethyl-N-(3-hydroxy-2,2-dimethylcyclobutyl)-4-nitropyrrole-2-carboxamide.
| Compound Name | 1-ethyl-N-(3-hydroxy-2,2-dimethylcyclobutyl)-4-nitropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114630719 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-ethyl-N-(3-hydroxy-2,2-dimethylcyclobutyl)-4-nitropyrrole-2-carboxamide |
| SMILES | CCn1cc([N+](=O)[O-])cc1C(=O)NC1CC(O)C1(C)C |
| InChI | InChI=1S/C13H19N3O4/c1-4-15-7-8(16(19)20)5-9(15)12(18)14-10-6-11(17)13(10,2)3/h5,7,10-11,17H,4,6H2,1-3H3,(H,14,18) |
| InChIKey | CRUJDULJFGSTOS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|