C13H19N3O5 — CID 82009497
5-[(1-ethyl-4-nitropyrrole-2-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 82009497) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 5-[(1-ethyl-4-nitropyrrole-2-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | 5-[(1-ethyl-4-nitropyrrole-2-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 82009497 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 5-[(1-ethyl-4-nitropyrrole-2-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CCn1cc([N+](=O)[O-])cc1C(=O)NCC(C)CCC(=O)O |
| InChI | InChI=1S/C13H19N3O5/c1-3-15-8-10(16(20)21)6-11(15)13(19)14-7-9(2)4-5-12(17)18/h6,8-9H,3-5,7H2,1-2H3,(H,14,19)(H,17,18) |
| InChIKey | KWSJEXMHBFGANK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|