C10H22N2O3S — CID 114631507
2-(diethylsulfamoylamino)-4-hydroxy-1,1-dimethylcyclobutane (PubChem CID 114631507) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-(diethylsulfamoylamino)-4-hydroxy-1,1-dimethylcyclobutane.
| Compound Name | 2-(diethylsulfamoylamino)-4-hydroxy-1,1-dimethylcyclobutane |
|---|---|
| PubChem CID | 114631507 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-(diethylsulfamoylamino)-4-hydroxy-1,1-dimethylcyclobutane |
| SMILES | CCN(CC)S(=O)(=O)NC1CC(O)C1(C)C |
| InChI | InChI=1S/C10H22N2O3S/c1-5-12(6-2)16(14,15)11-8-7-9(13)10(8,3)4/h8-9,11,13H,5-7H2,1-4H3 |
| InChIKey | DUOLZCIKQBIGCU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |