C10H17ClF3NO — CID 114631990
3-chloro-2,2-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclobutan-1-amine (PubChem CID 114631990) has the molecular formula C10H17ClF3NO and a molecular weight of 259.70 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclobutan-1-amine.
| Compound Name | 3-chloro-2,2-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 114631990 |
| Molecular Formula | C10H17ClF3NO |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclobutan-1-amine |
| SMILES | CC1(C)C(Cl)CC1NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H17ClF3NO/c1-9(2)7(11)5-8(9)15-3-4-16-6-10(12,13)14/h7-8,15H,3-6H2,1-2H3 |
| InChIKey | DNYUQSKCQJTOCX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|