C14H19FN2O — CID 114632325
N-(3-amino-2,2-dimethylcyclobutyl)-2-(2-fluorophenyl)acetamide (PubChem CID 114632325) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylcyclobutyl)-2-(2-fluorophenyl)acetamide.
| Compound Name | N-(3-amino-2,2-dimethylcyclobutyl)-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 114632325 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-(3-amino-2,2-dimethylcyclobutyl)-2-(2-fluorophenyl)acetamide |
| SMILES | CC1(C)C(N)CC1NC(=O)Cc1ccccc1F |
| InChI | InChI=1S/C14H19FN2O/c1-14(2)11(16)8-12(14)17-13(18)7-9-5-3-4-6-10(9)15/h3-6,11-12H,7-8,16H2,1-2H3,(H,17,18) |
| InChIKey | ZBQVJQBVFIRBDV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |