C10H17F3N2O — CID 114632369
N-(3-amino-2,2-dimethylcyclobutyl)-4,4,4-trifluorobutanamide (PubChem CID 114632369) has the molecular formula C10H17F3N2O and a molecular weight of 238.25 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylcyclobutyl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(3-amino-2,2-dimethylcyclobutyl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 114632369 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-(3-amino-2,2-dimethylcyclobutyl)-4,4,4-trifluorobutanamide |
| SMILES | CC1(C)C(N)CC1NC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O/c1-9(2)6(14)5-7(9)15-8(16)3-4-10(11,12)13/h6-7H,3-5,14H2,1-2H3,(H,15,16) |
| InChIKey | CSHOOTZDIIOMEN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |