C13H20N4O3 — CID 114632983
3-[[6-(ethylamino)-3-nitro-2-pyridinyl]amino]-2,2-dimethylcyclobutan-1-ol (PubChem CID 114632983) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-[[6-(ethylamino)-3-nitro-2-pyridinyl]amino]-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-[[6-(ethylamino)-3-nitro-2-pyridinyl]amino]-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 114632983 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-[[6-(ethylamino)-3-nitro-2-pyridinyl]amino]-2,2-dimethylcyclobutan-1-ol |
| SMILES | CCNc1ccc([N+](=O)[O-])c(NC2CC(O)C2(C)C)n1 |
| InChI | InChI=1S/C13H20N4O3/c1-4-14-11-6-5-8(17(19)20)12(16-11)15-9-7-10(18)13(9,2)3/h5-6,9-10,18H,4,7H2,1-3H3,(H2,14,15,16) |
| InChIKey | HCFGVGHVPZIFOY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|