C11H15N3O3 — CID 114630093
2,2-dimethyl-3-[(3-nitro-2-pyridinyl)amino]cyclobutan-1-ol (PubChem CID 114630093) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(3-nitro-2-pyridinyl)amino]cyclobutan-1-ol.
| Compound Name | 2,2-dimethyl-3-[(3-nitro-2-pyridinyl)amino]cyclobutan-1-ol |
|---|---|
| PubChem CID | 114630093 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2,2-dimethyl-3-[(3-nitro-2-pyridinyl)amino]cyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1Nc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N3O3/c1-11(2)8(6-9(11)15)13-10-7(14(16)17)4-3-5-12-10/h3-5,8-9,15H,6H2,1-2H3,(H,12,13) |
| InChIKey | NSQLGYQREIRJEO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|