C12H16BrN3O3 — CID 114630234
3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-2,2-dimethylcyclobutan-1-ol (PubChem CID 114630234) has the molecular formula C12H16BrN3O3 and a molecular weight of 330.18 g/mol. Its IUPAC name is 3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 114630234 |
| Molecular Formula | C12H16BrN3O3 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 3-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)amino]-2,2-dimethylcyclobutan-1-ol |
| SMILES | Cc1c([N+](=O)[O-])cnc(NC2CC(O)C2(C)C)c1Br |
| InChI | InChI=1S/C12H16BrN3O3/c1-6-7(16(18)19)5-14-11(10(6)13)15-8-4-9(17)12(8,2)3/h5,8-9,17H,4H2,1-3H3,(H,14,15) |
| InChIKey | GBTWDEFMXLAKGP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|