C10H13N3O2 — CID 61223122
N-(2,2-dimethylcyclopropyl)-3-nitropyridin-2-amine (PubChem CID 61223122) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopropyl)-3-nitropyridin-2-amine.
| Compound Name | N-(2,2-dimethylcyclopropyl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 61223122 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | N-(2,2-dimethylcyclopropyl)-3-nitropyridin-2-amine |
| SMILES | CC1(C)CC1Nc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N3O2/c1-10(2)6-8(10)12-9-7(13(14)15)4-3-5-11-9/h3-5,8H,6H2,1-2H3,(H,11,12) |
| InChIKey | DQWZCXRIWROCHS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|