C17H30N2O2 — CID 114633215
2-tert-butyl-1-(4-methoxy-1-propan-2-ylpyrazol-5-yl)cyclohexan-1-ol (PubChem CID 114633215) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-tert-butyl-1-(4-methoxy-1-propan-2-ylpyrazol-5-yl)cyclohexan-1-ol.
| Compound Name | 2-tert-butyl-1-(4-methoxy-1-propan-2-ylpyrazol-5-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 114633215 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 2-tert-butyl-1-(4-methoxy-1-propan-2-ylpyrazol-5-yl)cyclohexan-1-ol |
| SMILES | COc1cnn(C(C)C)c1C1(O)CCCCC1C(C)(C)C |
| InChI | InChI=1S/C17H30N2O2/c1-12(2)19-15(13(21-6)11-18-19)17(20)10-8-7-9-14(17)16(3,4)5/h11-12,14,20H,7-10H2,1-6H3 |
| InChIKey | YRPHCCBJKKLCIJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |