C16H29N3O — CID 114664853
3-(4-methoxy-1-propan-2-ylpyrazol-5-yl)-3-methyl-N-propylcyclopentan-1-amine (PubChem CID 114664853) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is 3-(4-methoxy-1-propan-2-ylpyrazol-5-yl)-3-methyl-N-propylcyclopentan-1-amine.
| Compound Name | 3-(4-methoxy-1-propan-2-ylpyrazol-5-yl)-3-methyl-N-propylcyclopentan-1-amine |
|---|---|
| PubChem CID | 114664853 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | 3-(4-methoxy-1-propan-2-ylpyrazol-5-yl)-3-methyl-N-propylcyclopentan-1-amine |
| SMILES | CCCNC1CCC(C)(c2c(OC)cnn2C(C)C)C1 |
| InChI | InChI=1S/C16H29N3O/c1-6-9-17-13-7-8-16(4,10-13)15-14(20-5)11-18-19(15)12(2)3/h11-13,17H,6-10H2,1-5H3 |
| InChIKey | IQYDMUBADVZGQW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |