C9H14N2O4S — CID 114633905
3-(4-methoxy-1-methylpyrazol-5-yl)-1,1-dioxothiolan-3-ol (PubChem CID 114633905) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 3-(4-methoxy-1-methylpyrazol-5-yl)-1,1-dioxothiolan-3-ol.
| Compound Name | 3-(4-methoxy-1-methylpyrazol-5-yl)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 114633905 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 3-(4-methoxy-1-methylpyrazol-5-yl)-1,1-dioxothiolan-3-ol |
| SMILES | COc1cnn(C)c1C1(O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H14N2O4S/c1-11-8(7(15-2)5-10-11)9(12)3-4-16(13,14)6-9/h5,12H,3-4,6H2,1-2H3 |
| InChIKey | KRCPTRGSXZANLW-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |