C16H22N2O3 — CID 114634160
(3-ethoxyphenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanol (PubChem CID 114634160) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3-ethoxyphenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanol.
| Compound Name | (3-ethoxyphenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 114634160 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (3-ethoxyphenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanol |
| SMILES | CCCn1ncc(OC)c1C(O)c1cccc(OCC)c1 |
| InChI | InChI=1S/C16H22N2O3/c1-4-9-18-15(14(20-3)11-17-18)16(19)12-7-6-8-13(10-12)21-5-2/h6-8,10-11,16,19H,4-5,9H2,1-3H3 |
| InChIKey | YIWZGMNYYPQHKT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |