C15H19FN2O3 — CID 114645087
(2-fluoro-4-methoxyphenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanol (PubChem CID 114645087) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is (2-fluoro-4-methoxyphenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanol.
| Compound Name | (2-fluoro-4-methoxyphenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 114645087 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (2-fluoro-4-methoxyphenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanol |
| SMILES | CCCn1ncc(OC)c1C(O)c1ccc(OC)cc1F |
| InChI | InChI=1S/C15H19FN2O3/c1-4-7-18-14(13(21-3)9-17-18)15(19)11-6-5-10(20-2)8-12(11)16/h5-6,8-9,15,19H,4,7H2,1-3H3 |
| InChIKey | FWTQKYIEIROEPU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |