C13H13ClF2N2O2 — CID 115837195
(4-chloro-2,5-difluorophenyl)-(1-ethyl-4-methoxypyrazol-5-yl)methanol (PubChem CID 115837195) has the molecular formula C13H13ClF2N2O2 and a molecular weight of 302.71 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-(1-ethyl-4-methoxypyrazol-5-yl)methanol.
| Compound Name | (4-chloro-2,5-difluorophenyl)-(1-ethyl-4-methoxypyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 115837195 |
| Molecular Formula | C13H13ClF2N2O2 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-(1-ethyl-4-methoxypyrazol-5-yl)methanol |
| SMILES | CCn1ncc(OC)c1C(O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H13ClF2N2O2/c1-3-18-12(11(20-2)6-17-18)13(19)7-4-10(16)8(14)5-9(7)15/h4-6,13,19H,3H2,1-2H3 |
| InChIKey | MFEZRLJQQAYGEF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|