C13H14Cl2N2O2 — CID 114635408
(3,5-dichlorophenyl)-(1-ethyl-4-methoxypyrazol-5-yl)methanol (PubChem CID 114635408) has the molecular formula C13H14Cl2N2O2 and a molecular weight of 301.17 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-(1-ethyl-4-methoxypyrazol-5-yl)methanol.
| Compound Name | (3,5-dichlorophenyl)-(1-ethyl-4-methoxypyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 114635408 |
| Molecular Formula | C13H14Cl2N2O2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (3,5-dichlorophenyl)-(1-ethyl-4-methoxypyrazol-5-yl)methanol |
| SMILES | CCn1ncc(OC)c1C(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2N2O2/c1-3-17-12(11(19-2)7-16-17)13(18)8-4-9(14)6-10(15)5-8/h4-7,13,18H,3H2,1-2H3 |
| InChIKey | KBXQYZWHTHRHQA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |