C13H22N2O3 — CID 114635857
4-(1-ethyl-4-methoxypyrazol-5-yl)-2,2-dimethyloxan-4-ol (PubChem CID 114635857) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-(1-ethyl-4-methoxypyrazol-5-yl)-2,2-dimethyloxan-4-ol.
| Compound Name | 4-(1-ethyl-4-methoxypyrazol-5-yl)-2,2-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 114635857 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 4-(1-ethyl-4-methoxypyrazol-5-yl)-2,2-dimethyloxan-4-ol |
| SMILES | CCn1ncc(OC)c1C1(O)CCOC(C)(C)C1 |
| InChI | InChI=1S/C13H22N2O3/c1-5-15-11(10(17-4)8-14-15)13(16)6-7-18-12(2,3)9-13/h8,16H,5-7,9H2,1-4H3 |
| InChIKey | CGLNHAAHSCXCIJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |