C15H26ClN3O2 — CID 114635870
4-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-ethyl-2-methyloxan-4-ol (PubChem CID 114635870) has the molecular formula C15H26ClN3O2 and a molecular weight of 315.85 g/mol. Its IUPAC name is 4-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-ethyl-2-methyloxan-4-ol.
| Compound Name | 4-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-ethyl-2-methyloxan-4-ol |
|---|---|
| PubChem CID | 114635870 |
| Molecular Formula | C15H26ClN3O2 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-ethyl-2-methyloxan-4-ol |
| SMILES | CCC1(C)CC(O)(c2c(Cl)cnn2CCN(C)C)CCO1 |
| InChI | InChI=1S/C15H26ClN3O2/c1-5-14(2)11-15(20,6-9-21-14)13-12(16)10-17-19(13)8-7-18(3)4/h10,20H,5-9,11H2,1-4H3 |
| InChIKey | KCYMQMWLEHUCIQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |