C15H27ClN4O — CID 114633711
4-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-propan-2-ylpiperidin-4-ol (PubChem CID 114633711) has the molecular formula C15H27ClN4O and a molecular weight of 314.86 g/mol. Its IUPAC name is 4-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-propan-2-ylpiperidin-4-ol.
| Compound Name | 4-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-propan-2-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 114633711 |
| Molecular Formula | C15H27ClN4O |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 4-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-propan-2-ylpiperidin-4-ol |
| SMILES | CC(C)N1CCC(O)(c2c(Cl)cnn2CCN(C)C)CC1 |
| InChI | InChI=1S/C15H27ClN4O/c1-12(2)19-7-5-15(21,6-8-19)14-13(16)11-17-20(14)10-9-18(3)4/h11-12,21H,5-10H2,1-4H3 |
| InChIKey | KJRVFHUCQJANNJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |