C12H20ClN3OS — CID 114636853
3-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-5-methylthiolan-3-ol (PubChem CID 114636853) has the molecular formula C12H20ClN3OS and a molecular weight of 289.83 g/mol. Its IUPAC name is 3-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-5-methylthiolan-3-ol.
| Compound Name | 3-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-5-methylthiolan-3-ol |
|---|---|
| PubChem CID | 114636853 |
| Molecular Formula | C12H20ClN3OS |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 3-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-5-methylthiolan-3-ol |
| SMILES | CC1CC(O)(c2c(Cl)cnn2CCN(C)C)CS1 |
| InChI | InChI=1S/C12H20ClN3OS/c1-9-6-12(17,8-18-9)11-10(13)7-14-16(11)5-4-15(2)3/h7,9,17H,4-6,8H2,1-3H3 |
| InChIKey | JDNBLTORIKAWRM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |