C15H23Cl2N3 — CID 114665693
2-[4-chloro-5-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 114665693) has the molecular formula C15H23Cl2N3 and a molecular weight of 316.28 g/mol. Its IUPAC name is 2-[4-chloro-5-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-chloro-5-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 114665693 |
| Molecular Formula | C15H23Cl2N3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-[4-chloro-5-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1ncc(Cl)c1C1=CC(Cl)CC(C)(C)C1 |
| InChI | InChI=1S/C15H23Cl2N3/c1-15(2)8-11(7-12(16)9-15)14-13(17)10-18-20(14)6-5-19(3)4/h7,10,12H,5-6,8-9H2,1-4H3 |
| InChIKey | GMQMBNZWMXKIRF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|