C12H19ClN4O — CID 114670583
(1-aminocyclobutyl)-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanone (PubChem CID 114670583) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is (1-aminocyclobutyl)-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanone.
| Compound Name | (1-aminocyclobutyl)-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 114670583 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (1-aminocyclobutyl)-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanone |
| SMILES | CN(C)CCn1ncc(Cl)c1C(=O)C1(N)CCC1 |
| InChI | InChI=1S/C12H19ClN4O/c1-16(2)6-7-17-10(9(13)8-15-17)11(18)12(14)4-3-5-12/h8H,3-7,14H2,1-2H3 |
| InChIKey | FWZXZEQBLHWHTE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |