C11H15N3O2S — CID 114638165
(4-methoxy-1-propylpyrazol-5-yl)-(1,3-thiazol-2-yl)methanol (PubChem CID 114638165) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is (4-methoxy-1-propylpyrazol-5-yl)-(1,3-thiazol-2-yl)methanol.
| Compound Name | (4-methoxy-1-propylpyrazol-5-yl)-(1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 114638165 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (4-methoxy-1-propylpyrazol-5-yl)-(1,3-thiazol-2-yl)methanol |
| SMILES | CCCn1ncc(OC)c1C(O)c1nccs1 |
| InChI | InChI=1S/C11H15N3O2S/c1-3-5-14-9(8(16-2)7-13-14)10(15)11-12-4-6-17-11/h4,6-7,10,15H,3,5H2,1-2H3 |
| InChIKey | WTTQHAVPWVCCCU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |