C10H12ClN3OS — CID 114638157
(4-chloro-1-propylpyrazol-5-yl)-(1,3-thiazol-2-yl)methanol (PubChem CID 114638157) has the molecular formula C10H12ClN3OS and a molecular weight of 257.75 g/mol. Its IUPAC name is (4-chloro-1-propylpyrazol-5-yl)-(1,3-thiazol-2-yl)methanol.
| Compound Name | (4-chloro-1-propylpyrazol-5-yl)-(1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 114638157 |
| Molecular Formula | C10H12ClN3OS |
| Molecular Weight | 257.75 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (4-chloro-1-propylpyrazol-5-yl)-(1,3-thiazol-2-yl)methanol |
| SMILES | CCCn1ncc(Cl)c1C(O)c1nccs1 |
| InChI | InChI=1S/C10H12ClN3OS/c1-2-4-14-8(7(11)6-13-14)9(15)10-12-3-5-16-10/h3,5-6,9,15H,2,4H2,1H3 |
| InChIKey | MUTNTXOBUQHEEL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.75 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |