C13H13ClF2N2O — CID 114634802
(4-chloro-1-propylpyrazol-5-yl)-(2,6-difluorophenyl)methanol (PubChem CID 114634802) has the molecular formula C13H13ClF2N2O and a molecular weight of 286.71 g/mol. Its IUPAC name is (4-chloro-1-propylpyrazol-5-yl)-(2,6-difluorophenyl)methanol.
| Compound Name | (4-chloro-1-propylpyrazol-5-yl)-(2,6-difluorophenyl)methanol |
|---|---|
| PubChem CID | 114634802 |
| Molecular Formula | C13H13ClF2N2O |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (4-chloro-1-propylpyrazol-5-yl)-(2,6-difluorophenyl)methanol |
| SMILES | CCCn1ncc(Cl)c1C(O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H13ClF2N2O/c1-2-6-18-12(8(14)7-17-18)13(19)11-9(15)4-3-5-10(11)16/h3-5,7,13,19H,2,6H2,1H3 |
| InChIKey | GOPPQOYRCVHZGT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |