C13H13Cl2FN2O — CID 114638648
(3-chloro-5-fluorophenyl)-(4-chloro-1-propylpyrazol-5-yl)methanol (PubChem CID 114638648) has the molecular formula C13H13Cl2FN2O and a molecular weight of 303.16 g/mol. Its IUPAC name is (3-chloro-5-fluorophenyl)-(4-chloro-1-propylpyrazol-5-yl)methanol.
| Compound Name | (3-chloro-5-fluorophenyl)-(4-chloro-1-propylpyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 114638648 |
| Molecular Formula | C13H13Cl2FN2O |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | (3-chloro-5-fluorophenyl)-(4-chloro-1-propylpyrazol-5-yl)methanol |
| SMILES | CCCn1ncc(Cl)c1C(O)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2FN2O/c1-2-3-18-12(11(15)7-17-18)13(19)8-4-9(14)6-10(16)5-8/h4-7,13,19H,2-3H2,1H3 |
| InChIKey | QCNPZZCWXDDQLF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |