C12H18ClF3N2O — CID 114638620
2-(4-chloro-1-propan-2-ylpyrazol-5-yl)-6,6,6-trifluorohexan-2-ol (PubChem CID 114638620) has the molecular formula C12H18ClF3N2O and a molecular weight of 298.74 g/mol. Its IUPAC name is 2-(4-chloro-1-propan-2-ylpyrazol-5-yl)-6,6,6-trifluorohexan-2-ol.
| Compound Name | 2-(4-chloro-1-propan-2-ylpyrazol-5-yl)-6,6,6-trifluorohexan-2-ol |
|---|---|
| PubChem CID | 114638620 |
| Molecular Formula | C12H18ClF3N2O |
| Molecular Weight | 298.74 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(4-chloro-1-propan-2-ylpyrazol-5-yl)-6,6,6-trifluorohexan-2-ol |
| SMILES | CC(C)n1ncc(Cl)c1C(C)(O)CCCC(F)(F)F |
| InChI | InChI=1S/C12H18ClF3N2O/c1-8(2)18-10(9(13)7-17-18)11(3,19)5-4-6-12(14,15)16/h7-8,19H,4-6H2,1-3H3 |
| InChIKey | JIVPRIRIBSCJOW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.74 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |