C14H15ClN2O3 — CID 114639797
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-phenoxyethanone (PubChem CID 114639797) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 114639797 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-phenoxyethanone |
| SMILES | COCCn1ncc(Cl)c1C(=O)COc1ccccc1 |
| InChI | InChI=1S/C14H15ClN2O3/c1-19-8-7-17-14(12(15)9-16-17)13(18)10-20-11-5-3-2-4-6-11/h2-6,9H,7-8,10H2,1H3 |
| InChIKey | IUZQYYMLZVPJKP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |