C10H15ClN2O4 — CID 114641389
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-dimethoxyethanone (PubChem CID 114641389) has the molecular formula C10H15ClN2O4 and a molecular weight of 262.69 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-dimethoxyethanone.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-dimethoxyethanone |
|---|---|
| PubChem CID | 114641389 |
| Molecular Formula | C10H15ClN2O4 |
| Molecular Weight | 262.69 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2,2-dimethoxyethanone |
| SMILES | COCCn1ncc(Cl)c1C(=O)C(OC)OC |
| InChI | InChI=1S/C10H15ClN2O4/c1-15-5-4-13-8(7(11)6-12-13)9(14)10(16-2)17-3/h6,10H,4-5H2,1-3H3 |
| InChIKey | OJIWRVLTSHPOAM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.69 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|