C12H18N2O2S2 — CID 114641533
1,4-dithian-2-yl-(4-methoxy-1-propylpyrazol-5-yl)methanone (PubChem CID 114641533) has the molecular formula C12H18N2O2S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 1,4-dithian-2-yl-(4-methoxy-1-propylpyrazol-5-yl)methanone.
| Compound Name | 1,4-dithian-2-yl-(4-methoxy-1-propylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 114641533 |
| Molecular Formula | C12H18N2O2S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1,4-dithian-2-yl-(4-methoxy-1-propylpyrazol-5-yl)methanone |
| SMILES | CCCn1ncc(OC)c1C(=O)C1CSCCS1 |
| InChI | InChI=1S/C12H18N2O2S2/c1-3-4-14-11(9(16-2)7-13-14)12(15)10-8-17-5-6-18-10/h7,10H,3-6,8H2,1-2H3 |
| InChIKey | UJONXEIOFPFOEG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |