C12H13ClN2O2S — CID 115810952
(3-chlorothiophen-2-yl)-(4-methoxy-1-propylpyrazol-5-yl)methanone (PubChem CID 115810952) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is (3-chlorothiophen-2-yl)-(4-methoxy-1-propylpyrazol-5-yl)methanone.
| Compound Name | (3-chlorothiophen-2-yl)-(4-methoxy-1-propylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 115810952 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | (3-chlorothiophen-2-yl)-(4-methoxy-1-propylpyrazol-5-yl)methanone |
| SMILES | CCCn1ncc(OC)c1C(=O)c1sccc1Cl |
| InChI | InChI=1S/C12H13ClN2O2S/c1-3-5-15-10(9(17-2)7-14-15)11(16)12-8(13)4-6-18-12/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | ZEKSCTAESPNQRH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |