C11H10BrClN2OS — CID 115805645
(3-bromothiophen-2-yl)-(4-chloro-1-propylpyrazol-5-yl)methanone (PubChem CID 115805645) has the molecular formula C11H10BrClN2OS and a molecular weight of 333.64 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-(4-chloro-1-propylpyrazol-5-yl)methanone.
| Compound Name | (3-bromothiophen-2-yl)-(4-chloro-1-propylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 115805645 |
| Molecular Formula | C11H10BrClN2OS |
| Molecular Weight | 333.64 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | (3-bromothiophen-2-yl)-(4-chloro-1-propylpyrazol-5-yl)methanone |
| SMILES | CCCn1ncc(Cl)c1C(=O)c1sccc1Br |
| InChI | InChI=1S/C11H10BrClN2OS/c1-2-4-15-9(8(13)6-14-15)10(16)11-7(12)3-5-17-11/h3,5-6H,2,4H2,1H3 |
| InChIKey | UDFNIOUSDOGNBP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |