C14H14ClFN2O2 — CID 114640314
(3-chloro-2-fluorophenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanone (PubChem CID 114640314) has the molecular formula C14H14ClFN2O2 and a molecular weight of 296.73 g/mol. Its IUPAC name is (3-chloro-2-fluorophenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanone.
| Compound Name | (3-chloro-2-fluorophenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 114640314 |
| Molecular Formula | C14H14ClFN2O2 |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (3-chloro-2-fluorophenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanone |
| SMILES | CCCn1ncc(OC)c1C(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C14H14ClFN2O2/c1-3-7-18-13(11(20-2)8-17-18)14(19)9-5-4-6-10(15)12(9)16/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | MSFQYMRXYKNEBQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |