C15H16ClFN2O2 — CID 114642210
2-(3-chloro-2-fluorophenyl)-1-(4-methoxy-1-propylpyrazol-5-yl)ethanone (PubChem CID 114642210) has the molecular formula C15H16ClFN2O2 and a molecular weight of 310.76 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-(4-methoxy-1-propylpyrazol-5-yl)ethanone.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-(4-methoxy-1-propylpyrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 114642210 |
| Molecular Formula | C15H16ClFN2O2 |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-(4-methoxy-1-propylpyrazol-5-yl)ethanone |
| SMILES | CCCn1ncc(OC)c1C(=O)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C15H16ClFN2O2/c1-3-7-19-15(13(21-2)9-18-19)12(20)8-10-5-4-6-11(16)14(10)17/h4-6,9H,3,7-8H2,1-2H3 |
| InChIKey | KQDMJWDNGZYRKD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |