C13H14FN3O2 — CID 114641960
(3-fluoro-4-pyridinyl)-(4-methoxy-1-propylpyrazol-5-yl)methanone (PubChem CID 114641960) has the molecular formula C13H14FN3O2 and a molecular weight of 263.27 g/mol. Its IUPAC name is (3-fluoro-4-pyridinyl)-(4-methoxy-1-propylpyrazol-5-yl)methanone.
| Compound Name | (3-fluoro-4-pyridinyl)-(4-methoxy-1-propylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 114641960 |
| Molecular Formula | C13H14FN3O2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (3-fluoro-4-pyridinyl)-(4-methoxy-1-propylpyrazol-5-yl)methanone |
| SMILES | CCCn1ncc(OC)c1C(=O)c1ccncc1F |
| InChI | InChI=1S/C13H14FN3O2/c1-3-6-17-12(11(19-2)8-16-17)13(18)9-4-5-15-7-10(9)14/h4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | KWROOKQZDDWWIG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |