C14H16BrN3O2 — CID 114670253
(2-amino-4-bromophenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanone (PubChem CID 114670253) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is (2-amino-4-bromophenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanone.
| Compound Name | (2-amino-4-bromophenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 114670253 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | (2-amino-4-bromophenyl)-(4-methoxy-1-propylpyrazol-5-yl)methanone |
| SMILES | CCCn1ncc(OC)c1C(=O)c1ccc(Br)cc1N |
| InChI | InChI=1S/C14H16BrN3O2/c1-3-6-18-13(12(20-2)8-17-18)14(19)10-5-4-9(15)7-11(10)16/h4-5,7-8H,3,6,16H2,1-2H3 |
| InChIKey | WZYDTGSYMBKMRC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|